AD79317
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $25.00 | $18.00 | - + | |
5g | 95% | in stock | $34.00 | $24.00 | - + | |
25g | 95% | in stock | $73.00 | $51.00 | - + | |
100g | 95% | in stock | $188.00 | $132.00 | - + | |
500g | 95% | in stock | $547.00 | $383.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD79317 |
Chemical Name: | Tetrabenzylthiuram disulfide |
CAS Number: | 10591-85-2 |
Molecular Formula: | C30H28N2S4 |
Molecular Weight: | 544.8167 |
MDL Number: | MFCD09842304 |
SMILES: | S=C(N(Cc1ccccc1)Cc1ccccc1)SSC(=S)N(Cc1ccccc1)Cc1ccccc1 |
NSC Number: | 608475 |
Complexity: | 551 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 36 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 11 |
XLogP3: | 7.7 |
Journal of medicinal chemistry 20091126
Journal of medicinal chemistry 19960913