logo
Home  > Chemistry  > Organic Building Blocks  > Aliphatic Cyclic Hydrocarbons  > Cis-2-fluoro-cyclopropanecarboxylic acid

AI06862

105919-34-4 | Cis-2-fluoro-cyclopropanecarboxylic acid

Packsize Purity Availability Price Discounted Price    Quantity
250mg 97% in stock $19.00 $13.00 -   +
1g 97% in stock $30.00 $21.00 -   +
5g 97% in stock $104.00 $73.00 -   +
10g 97% in stock $197.00 $138.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AI06862
Chemical Name: Cis-2-fluoro-cyclopropanecarboxylic acid
CAS Number: 105919-34-4
Molecular Formula: C8H10F2O4
Molecular Weight: 208.1594
MDL Number: MFCD04972869
SMILES: OC(=O)[C@H]1C[C@H]1F.OC(=O)[C@@H]1C[C@@H]1F

 

Computed Properties
Complexity: 102  
Covalently-Bonded Unit Count: 1  
Defined Atom Stereocenter Count: 2  
Heavy Atom Count: 7  
Hydrogen Bond Acceptor Count: 3  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 1  
XLogP3: 0.3  

 

 

Upstream Synthesis Route
  • The cis-2-Fluorocyclopropanecarboxylic acid is a valuable building block in chemical synthesis, particularly in the field of pharmaceuticals and agrochemicals. This compound is known for its unique three-membered cyclopropane ring structure and the fluorine substituent attached in a cis configuration.In chemical synthesis, cis-2-Fluorocyclopropanecarboxylic acid can be utilized as a key intermediate in the preparation of various biologically active compounds. Its cyclopropane ring imparts significant strain energy, making it a versatile component for constructing complex molecular frameworks. Additionally, the presence of the fluorine atom enhances the compound's reactivity and can also influence the physicochemical properties of the final products.By incorporating cis-2-Fluorocyclopropanecarboxylic acid into synthetic routes, chemists can access novel molecules with potentially enhanced biological activities or improved pharmacokinetic profiles. Its use can lead to the development of new drug candidates, crop protection agents, or other valuable chemical entities.
FEATURED PRODUCTS