AB68155
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $54.00 | $38.00 | - + | |
5g | 97% | in stock | $185.00 | $130.00 | - + | |
10g | 97% | in stock | $297.00 | $208.00 | - + | |
25g | 97% | in stock | $572.00 | $400.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB68155 |
Chemical Name: | N-Hydroxy-4-nitrophthalimide |
CAS Number: | 105969-98-0 |
Molecular Formula: | C8H4N2O5 |
Molecular Weight: | 208.1278 |
MDL Number: | MFCD01115771 |
SMILES: | ON1C(=O)c2c(C1=O)cc(cc2)[N+](=O)[O-] |
Complexity: | 336 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 0.7 |
4-Nitrophthaloxime is a versatile compound widely used in chemical synthesis for its unique properties and reactivity. As a nitroso compound, it serves as a valuable building block in organic chemistry, playing a crucial role in the synthesis of various compounds and materials.One of the key applications of 4-Nitrophthaloxime is in the preparation of heterocyclic compounds. By undergoing condensation reactions with various nucleophiles, this compound can be utilized to synthesize a wide range of structurally diverse heterocycles. These heterocyclic compounds are essential in pharmaceuticals, agrochemicals, and materials science, making 4-Nitrophthaloxime a valuable tool for chemists seeking to access these important building blocks.Furthermore, 4-Nitrophthaloxime can also be employed in the preparation of complex organic molecules through multistep synthesis routes. Its unique reactivity allows for selective functionalization and modification of aromatic structures, enabling chemists to efficiently access intricate molecular architectures.In addition, 4-Nitrophthaloxime serves as a precursor in the synthesis of various coordination complexes and metal complexes. Its ability to chelate with metal ions makes it a key component in the design and preparation of catalysts, sensors, and other metal-containing materials with tailored properties.Overall, the versatility and reactivity of 4-Nitrophthaloxime make it an indispensable tool in modern chemical synthesis, enabling the efficient construction of complex molecules and materials with diverse applications.