logo
Home  > 7-Benzyl-2,4-dichloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine

AB50460

1059735-34-0 | 7-Benzyl-2,4-dichloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine

Packsize Purity Availability Price Discounted Price    Quantity
250mg 98% in stock $12.00 $9.00 -   +
1g 98% in stock $15.00 $11.00 -   +
5g 98% in stock $74.00 $52.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB50460
Chemical Name: 7-Benzyl-2,4-dichloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine
CAS Number: 1059735-34-0
Molecular Formula: C14H13Cl2N3
Molecular Weight: 294.1791
MDL Number: MFCD11846183
SMILES: Clc1nc2CN(CCc2c(n1)Cl)Cc1ccccc1

 

Upstream Synthesis Route 
  • 7-Benzyl-2,4-dichloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine plays a crucial role in chemical synthesis as a versatile building block. This compound is utilized as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and complex organic molecules. Its unique molecular structure enables it to participate in a range of synthetic reactions, making it valuable for creating diverse chemical compounds with specific properties and functions. In the field of organic chemistry, 7-Benzyl-2,4-dichloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine serves as a strategic starting material for the development of novel molecules with potential applications in various industries.
FEATURED PRODUCTS