logo
Home  > 4-Bromo-1-methyl-3-phenyl-1H-pyrazole

AD68154

105994-55-6 | 4-Bromo-1-methyl-3-phenyl-1H-pyrazole

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $121.00 $85.00 -   +
250mg 95% in stock $193.00 $135.00 -   +
1g 95% in stock $510.00 $357.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AD68154
Chemical Name: 4-Bromo-1-methyl-3-phenyl-1H-pyrazole
CAS Number: 105994-55-6
Molecular Formula: C11H10N2O2
Molecular Weight: 202.2093
MDL Number: MFCD05664675
SMILES: Cn1cc(c(n1)c1ccccc1)C(=O)O

 

Upstream Synthesis Route 
  • 4-Bromo-1-methyl-3-phenyl-1H-pyrazole, a versatile chemical compound, plays a crucial role in chemical synthesis processes. This compound is widely utilized as a building block in the preparation of various pharmaceuticals, agrochemicals, and materials. Its unique structure and reactivity make it an essential intermediate in organic synthesis. By reacting with different reagents and undergoing various transformations, 4-Bromo-1-methyl-3-phenyl-1H-pyrazole can be modified to introduce different functional groups, ultimately leading to the synthesis of diverse complex molecules. Its application extends to the development of novel drugs, advanced materials, and other important chemical products.
FEATURED PRODUCTS