logo
Home  > Bis(6-methylheptyl) azelate

AE47503

106-03-6 | Bis(6-methylheptyl) azelate

Packsize Purity Availability Price Discounted Price    Quantity
10mg 95% 2 weeks $677.00 $474.00 -   +
25mg 95% 2 weeks $1,007.00 $705.00 -   +
100mg 95% 2 weeks $1,996.00 $1,397.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE47503
Chemical Name: Bis(6-methylheptyl) azelate
CAS Number: 106-03-6
Molecular Formula: C25H48O4
Molecular Weight: 412.6462
SMILES: CC(C)CCCCCOC(=O)CCCCCCCC(=O)OCCCCCC(C)C

 

Upstream Synthesis Route
  • Bis(6-methylheptyl) azelate, a compound commonly used in chemical synthesis, serves as a versatile building block in organic chemistry applications. With its unique molecular structure, this substance offers significant utility in the creation of various specialty chemicals, polymers, and complex organic compounds. Specifically, Bis(6-methylheptyl) azelate functions as a valuable reagent in the synthesis of esters, providing a means to introduce specific functionalities and properties into a wide range of chemical products. This compound's ability to participate in esterification reactions makes it a key component in the development of novel materials and formulations, ultimately contributing to advancements in diverse industrial sectors such as pharmaceuticals, cosmetics, and materials science. In chemical synthesis, Bis(6-methylheptyl) azelate plays a crucial role in enabling the precise manipulation of chemical structures, facilitating the creation of tailored molecules with tailored properties and functionalities.
FEATURED PRODUCTS