AB43128
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $11.00 | $8.00 | - + | |
250mg | 98% | in stock | $20.00 | $14.00 | - + | |
1g | 95% | in stock | $32.00 | $23.00 | - + | |
5g | 95% | in stock | $159.00 | $112.00 | - + | |
25g | 93% | in stock | $515.00 | $360.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB43128 |
Chemical Name: | 1,3-Bis[3,5-bis(trifluoromethyl)phenyl]thiourea |
CAS Number: | 1060-92-0 |
Molecular Formula: | C17H8F12N2S |
Molecular Weight: | 500.3047 |
MDL Number: | MFCD00829878 |
SMILES: | S=C(Nc1cc(cc(c1)C(F)(F)F)C(F)(F)F)Nc1cc(cc(c1)C(F)(F)F)C(F)(F)F |
Complexity: | 556 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 32 |
Hydrogen Bond Acceptor Count: | 13 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 6.6 |
Beilstein journal of organic chemistry 20070101