AD67921
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $15.00 | $10.00 | - + | |
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $16.00 | $12.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD67921 |
Chemical Name: | 5-Methoxy-3-formylindole |
CAS Number: | 10601-19-1 |
Molecular Formula: | C10H9NO2 |
Molecular Weight: | 175.18396 |
MDL Number: | MFCD00005623 |
SMILES: | COc1ccc2c(c1)c(C=O)c[nH]2 |
NSC Number: | 521754 |
Complexity: | 195 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.7 |
5-Methoxyindole-3-carboxaldehyde is a versatile chemical compound commonly used in chemical synthesis as a key building block for various pharmaceuticals, agrochemicals, and materials. This aldehyde compound serves as a valuable intermediate in the synthesis of indole derivatives, which are important structural motifs found in many biologically active compounds. Particularly, 5-Methoxyindole-3-carboxaldehyde is utilized in the production of indole-based heterocycles, such as tryptamine derivatives and serotonin receptor agonists.Additionally, this compound plays a crucial role in the development of novel organic materials due to its ability to undergo diverse chemical transformations, including condensation reactions and nucleophilic additions. Its unique structure offers opportunities for the creation of functionalized indole scaffolds with tailored properties for applications in medicinal chemistry, materials science, and drug discovery.Overall, the application of 5-Methoxyindole-3-carboxaldehyde in chemical synthesis enables the efficient and strategic synthesis of complex molecules with diverse functionalities, making it a valuable tool for researchers in the fields of organic chemistry and drug development.
Cytometry. Part A : the journal of the International Society for Analytical Cytology 20060501