logo
Home  > 1-(6-Methoxypyridin-3-yl)cyclopropanecarboxylic acid

AX14994

1060807-02-4 | 1-(6-Methoxypyridin-3-yl)cyclopropanecarboxylic acid

Packsize Purity Availability Price Discounted Price    Quantity
50mg 95% in stock $350.00 $245.00 -   +
250mg 95% in stock $660.00 $462.00 -   +
1g 95% in stock $1,368.00 $957.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AX14994
Chemical Name: 1-(6-Methoxypyridin-3-yl)cyclopropanecarboxylic acid
CAS Number: 1060807-02-4
Molecular Formula: C10H11NO3
Molecular Weight: 193.1992
MDL Number: MFCD13188756
SMILES: COc1ccc(cn1)C1(CC1)C(=O)O

 

Upstream Synthesis Route 
  • The 1-(6-methoxy-3-pyridinyl)cyclopropanecarboxylic acid is a valuable compound widely used in chemical synthesis as a versatile building block. Its unique structure and functional groups make it a crucial component in the development of various organic molecules. This compound plays a significant role in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals due to its ability to participate in diverse chemical reactions, such as cycloadditions, nucleophilic substitutions, and cross-coupling reactions. Furthermore, the 1-(6-methoxy-3-pyridinyl)cyclopropanecarboxylic acid serves as a key intermediate in the creation of complex organic frameworks and provides a strategic advantage in designing and accessing structurally diverse compounds with desirable properties.
FEATURED PRODUCTS