1060810-79-8 | 4-Hydroxy-6-(trifluoromethyl)nicotinic acid

Packsize	Purity	Availability	Price	Discounted Price
100mg	95%	in stock	$273.00	$192.00
250mg	95%	in stock	$440.00	$308.00
1g	95%	in stock	$1,241.00	$869.00

Description

• Catalog Number: AE15766
• Chemical Name: 4-Hydroxy-6-(trifluoromethyl)nicotinic acid
• CAS Number: 1060810-79-8
• Molecular Formula: C7H4F3NO3
• Molecular Weight: 207.1068
• MDL Number: MFCD28138139
• SMILES: OC(=O)c1cnc(cc1O)C(F)(F)F

Upstream Synthesis Route

4-Hydroxy-6-(trifluoromethyl)-3-pyridinecarboxylic acid, also known as $name$, is a versatile compound widely used in chemical synthesis. This compound serves as a key building block in the production of various pharmaceuticals, agrochemicals, and functional materials. Its unique chemical structure and properties make it particularly valuable in the following applications:1. Building Blocks and Intermediates: $name$ is used as a crucial building block in the synthesis of complex organic molecules. Its trifluoromethyl group and hydroxy functionality can be selectively modified to introduce specific chemical functionalities, enabling the construction of diverse molecular structures.2. Medicinal Chemistry: In the field of drug discovery and development, $name$ plays a significant role in the synthesis of biologically active compounds. Its presence in the molecular backbone of pharmaceutical agents can enhance their pharmacological properties, such as bioavailability, potency, and metabolic stability.3. Agrochemicals: The synthesis of crop protection agents and plant growth regulators often involves the incorporation of fluorinated moieties. $name$'s trifluoromethyl group imparts desirable properties to agrochemicals, such as enhanced efficacy, improved selectivity, and resistance to biodegradation.4. Materials Science: $name$ is utilized in the preparation of functional materials with tailored properties, such as polymers, catalysts, and specialty chemicals. Its presence can influence the material's physical, chemical, and electronic characteristics, leading to advanced applications in areas like electronics, coatings, and adhesives.Overall, 4-Hydroxy-6-(trifluoromethyl)-3-pyridinecarboxylic acid is a valuable compound in chemical synthesis, offering a wide range of applications in various industries. Its versatility and reactivity make it a vital component in the development of novel molecules and materials for diverse purposes.