106154-18-1 | 6,8,11,14-Eicosatetraenoicacid, 5-oxo-, (6E,8Z,11Z,14Z)-

Availability
Typically In Stock

Description

• Catalog Number: AD43980
• Chemical Name: 6,8,11,14-Eicosatetraenoicacid, 5-oxo-, (6E,8Z,11Z,14Z)-
• CAS Number: 106154-18-1
• MDL Number: MFCD00216129
• SMILES: CCCCC/C=C\C/C=C\C/C=C\C=C/C(=O)CCCC(=O)O

Upstream Synthesis Route

5-oxo-ETE, or 5-oxo-eicosatetraenoic acid, plays a crucial role in chemical synthesis as a versatile intermediate compound. Its unique chemical structure and reactivity make it a valuable tool in organic synthesis, particularly in the creation of bioactive molecules and pharmaceuticals. Due to its ability to undergo various chemical transformations, 5-oxo-ETE serves as a building block for the synthesis of complex organic molecules with specific applications in the pharmaceutical industry. Researchers utilize its reactive functional groups to introduce specific chemical motifs and tailor the properties of target compounds. By leveraging the chemical reactivity of 5-oxo-ETE, chemists can efficiently access a diverse range of structurally diverse compounds with potential therapeutic benefits. Its versatility and utility in chemical synthesis make 5-oxo-ETE a valuable component in the development of novel drugs and bioactive compounds.