AE14324
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 3 weeks | $428.00 | $300.00 | - + | ||
50mg | 3 weeks | $2,189.00 | $1,532.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE14324 |
Chemical Name: | cis-Piceatannol |
CAS Number: | 106325-86-4 |
Molecular Formula: | C14H12O4 |
Molecular Weight: | 244.2427 |
MDL Number: | MFCD28898461 |
SMILES: | Oc1cc(C=Cc2ccc(c(c2)O)O)cc(c1)O |
Cis-Piceatannol, a naturally occurring stilbenoid found in various plant sources such as passion fruit seeds and white tea, shows great potential in chemical synthesis applications. This compound exhibits unique properties that make it a valuable building block in organic chemistry. One of the key applications of cis-Piceatannol in chemical synthesis is its role as a versatile precursor for the synthesis of more complex molecules. Its structural characteristics allow for various functional group transformations, making it a valuable starting material for the preparation of diverse derivatives. Chemists can utilize the hydroxyl groups on the molecule to introduce other substituents through selective chemical reactions, leading to the generation of novel compounds with tailored properties.Furthermore, cis-Piceatannol's ability to undergo oxidative transformations enables its use in the synthesis of polyphenolic compounds and related natural products. By harnessing its reactivity under controlled conditions, chemists can access structurally intricate molecules that may have biological activities or industrial applications. The presence of multiple reactive sites in cis-Piceatannol offers opportunities for regioselective modifications, allowing for the strategic construction of complex chemical frameworks.Overall, the versatile nature of cis-Piceatannol in chemical synthesis highlights its significance as a valuable tool for the creation of diverse compounds with potential applications in pharmaceuticals, materials science, and other fields. Its ability to serve as a key intermediate in synthetic pathways underscores its importance in the realm of organic chemistry and innovative molecule design.