AE09079
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $14.00 | $10.00 | - + | |
5mg | 98% | in stock | $27.00 | $19.00 | - + | |
10mg | 98% | in stock | $36.00 | $25.00 | - + | |
25mg | 98% | in stock | $50.00 | $35.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE09079 |
Chemical Name: | (D-ALA1)-PEPTIDE T AMIDE |
CAS Number: | 106362-34-9 |
Molecular Formula: | C35H56N10O15 |
Molecular Weight: | 856.8771 |
MDL Number: | MFCD00076838 |
SMILES: | OC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N)[C@H](O)C)Cc1ccc(cc1)O)CC(=O)N)[C@H](O)C)[C@H](O)C)[C@H](O)C)NC(=O)[C@H](N)C |
DAPTA, a potent peptidomimetic compound, is widely utilized in chemical synthesis as a tool for designing and developing novel drug molecules. Its unique structure and properties allow for precise interactions with target proteins, making it an invaluable asset in the creation of therapeutically relevant compounds. As a versatile building block, DAPTA plays a crucial role in the construction of peptide-based drugs and bioactive compounds through solid-phase peptide synthesis (SPPS) and other synthetic methodologies. By leveraging DAPTA in chemical synthesis, researchers can access new avenues for drug discovery and development, ultimately leading to the creation of innovative pharmaceutical solutions.