logo
Home  > 6-N-Biotinylaminohexanol

AD77913

106451-92-7 | 6-N-Biotinylaminohexanol

Packsize Purity Availability Price Discounted Price    Quantity
50mg 95% in stock $175.00 $123.00 -   +
100mg 95% in stock $243.00 $170.00 -   +
250mg 95% in stock $372.00 $260.00 -   +
1g 95% in stock $931.00 $652.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AD77913
Chemical Name: 6-N-Biotinylaminohexanol
CAS Number: 106451-92-7
Molecular Formula: C16H29N3O3S
Molecular Weight: 343.4848
MDL Number: MFCD03788815
SMILES: OCCCCCCNC(=O)CCCC[C@@H]1SCC2C1NC(=O)N2

 

Upstream Synthesis Route
  • 6-N-Biotinylaminohexanol is a versatile compound that plays a crucial role in chemical synthesis processes. As a derivative of biotin, this compound is commonly employed as a key building block in the synthesis of various biotinylated molecules. Its unique structure, consisting of a six-carbon chain with an amino group and a biotin moiety, makes it an ideal linker in the conjugation of biotin to target molecules.In chemical synthesis, 6-N-Biotinylaminohexanol is frequently utilized in the production of biotinylated probes, reagents, and biomolecules for various applications. By functionalizing target molecules with biotin using this compound, researchers can easily attach these molecules to streptavidin-coated surfaces for bioconjugation studies, enzyme assays, protein purification, and molecular detection methods such as ELISA and western blotting.Moreover, the presence of both a biotin group and an amino group in 6-N-Biotinylaminohexanol allows for additional modifications through standard peptide chemistry, enabling the introduction of specific functional groups or labels for tailored applications. Overall, the strategic use of 6-N-Biotinylaminohexanol in chemical synthesis facilitates the development of advanced bioconjugates and molecular probes with enhanced specificity and functionality.${name}$
FEATURED PRODUCTS