AE18419
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $213.00 | $149.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE18419 |
Chemical Name: | AZADIRACHTIN B(SH) |
CAS Number: | 106500-25-8 |
Molecular Formula: | C33H42O14 |
Molecular Weight: | 662.6782 |
MDL Number: | MFCD01321056 |
SMILES: | COC(=O)[C@H]1OC[C@]23[C@@H]1[C@@](C)([C@H](O)[C@H]1[C@H]3[C@@]([C@@H](C[C@@H]2O)OC(=O)/C(=C/C)/C)(CO1)C(=O)OC)[C@@]12O[C@@]2(C)[C@H]2C[C@@H]1O[C@H]1[C@]2(O)C=CO1 |
Azadirachtin B, a natural insecticide derived from the neem tree, is utilized in chemical synthesis for its potent bioactivity and environmentally friendly properties. This powerful compound serves as a key ingredient in the development of novel pesticides, herbicides, and insect repellents due to its ability to disrupt insect growth, feeding behaviors, and reproduction processes. Additionally, Azadirachtin B's biodegradable nature makes it a sustainable choice for controlling pest populations while minimizing harm to beneficial organisms and the ecosystem. In chemical synthesis, it can be incorporated into formulations to create effective and eco-friendly pest control solutions for agricultural, horticultural, and pharmaceutical applications.