AD42590
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 98% | in stock | $40.00 | $28.00 | - + | |
10mg | 98% | in stock | $64.00 | $45.00 | - + | |
25mg | 98% | in stock | $140.00 | $98.00 | - + | |
50mg | 98% | in stock | $224.00 | $157.00 | - + | |
100mg | 98% | in stock | $358.00 | $250.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD42590 |
Chemical Name: | Sertindole |
CAS Number: | 106516-24-9 |
Molecular Formula: | C24H26ClFN4O |
Molecular Weight: | 440.9408 |
MDL Number: | MFCD00867749 |
SMILES: | Clc1ccc2c(c1)c(cn2c1ccc(cc1)F)C1CCN(CC1)CCN1CCNC1=O |
Sertindole, a versatile pharmaceutical compound, plays a crucial role in chemical synthesis as a key building block for the creation of various important drug molecules. Through its unique structural properties and reactivity, Sertindole serves as a valuable intermediate in the synthesis of complex organic compounds used in the pharmaceutical industry. Its functional groups enable it to participate in a wide range of chemical reactions, such as nucleophilic substitutions, oxidative transformations, and coupling reactions, making it a versatile tool for chemists in designing and developing new therapeutic agents. Whether in the production of antipsychotic drugs or other pharmaceuticals, the application of Sertindole in chemical synthesis demonstrates its significant potential in advancing drug discovery and development.