AE31647
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $189.00 | $132.00 | - + | |
1g | 95% | in stock | $499.00 | $349.00 | - + | |
5g | 95% | in stock | $2,157.00 | $1,510.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE31647 |
Chemical Name: | tert-Butyl 4-(hydroxymethyl)azepane-1-carboxylate |
CAS Number: | 1065608-51-6 |
Molecular Formula: | C12H23NO3 |
Molecular Weight: | 229.3159 |
MDL Number: | MFCD18088895 |
SMILES: | OCC1CCCN(CC1)C(=O)OC(C)(C)C |
Complexity: | 235 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 1.5 |
Utilizing tert-Butyl 4-(hydroxymethyl)azepane-1-carboxylate in chemical synthesis serves as a crucial intermediate in the creation of various pharmaceutical compounds and complex organic molecules. This versatile compound functions as a valuable building block with potential applications in the fabrication of drug candidates, agrochemicals, and materials science. By incorporating tert-Butyl 4-(hydroxymethyl)azepane-1-carboxylate into synthetic routes, chemists can strategically introduce functional groups and stereochemical elements, enabling precise control over the structure and properties of the final products. Its unique chemical reactivity and structural attributes make it an indispensable tool for the synthesis of biologically active compounds and intricate organic frameworks.