AD66094
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $33.00 | $23.00 | - + | |
5mg | 95% | in stock | $75.00 | $52.00 | - + | |
10mg | 95% | in stock | $113.00 | $79.00 | - + | |
25mg | 95% | in stock | $280.00 | $196.00 | - + | |
50mg | 95% | in stock | $469.00 | $329.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD66094 |
Chemical Name: | Tellurate(1-), trichloro[1,2-ethanediolato(2-)-κO1,κO2]-, ammonium (1:1), (SP-5-22)- |
CAS Number: | 106566-58-9 |
Molecular Formula: | C2H8Cl3NO2Te |
Molecular Weight: | 312.0494 |
MDL Number: | MFCD01682758 |
SMILES: | [Cl-][Te+4]1([Cl-])([Cl-])[O-]CC[O-]1.[NH4+] |
Complexity: | 97.6 |
Covalently-Bonded Unit Count: | 2 |
Formal Charge: | 1 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
The ammonium salt of trichloro[1,2-ethanediolato(2-)-κO1,κO2]tellurate(1-) (SP-5-22) is a versatile compound commonly used in chemical synthesis for its unique properties. This compound serves as an effective oxidizing agent in various reactions, particularly in the synthesis of organic compounds and coordination complexes. Tellurate(1-) compounds have shown promising results in promoting selective oxidations and functional group transformations in the presence of other reagents. Its application in chemical synthesis extends to the production of specialty chemicals, pharmaceutical intermediates, and materials with tailored properties.