AE15453
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $113.00 | $79.00 | - + | |
5mg | 98% | in stock | $225.00 | $157.00 | - + | |
10mg | 98% | in stock | $343.00 | $240.00 | - + | |
25mg | 98% | in stock | $515.00 | $360.00 | - + | |
50mg | 98% | in stock | $696.00 | $487.00 | - + | |
100mg | 98% | in stock | $969.00 | $678.00 | - + | |
250mg | 98% | in stock | $1,723.00 | $1,206.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE15453 |
Chemical Name: | WR-238605 |
CAS Number: | 106635-81-8 |
Molecular Formula: | C28H34F3N3O7 |
Molecular Weight: | 581.5806696 |
MDL Number: | MFCD00892249 |
SMILES: | OC(=O)CCC(=O)O.NCCCC(Nc1cc(OC)c(c2c1nc(OC)cc2C)Oc1cccc(c1)C(F)(F)F)C |
Tafenoquine succinate, a key component in chemical synthesis, plays a crucial role in various applications within the field. This compound is primarily utilized as a precursor in the creation of pharmaceutical agents, specifically in the development of antimalarial drugs. By serving as a building block for the synthesis of these medications, tafenoquine succinate aids in the production of essential treatments that combat malaria infections. Additionally, its chemical properties enable researchers to explore novel synthetic pathways and enhance the efficiency of drug production processes. In the realm of organic chemistry, tafenoquine succinate serves as a valuable tool for manipulating molecular structures and facilitating the creation of diverse chemical compounds with therapeutic potential. Its versatility and reliability in chemical synthesis make it a fundamental component in the pharmaceutical industry's efforts to combat malaria and other diseases.