AE15887
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE15887 |
Chemical Name: | 2-(4-Amino-2-ethoxyphenyl)pthalimide |
CAS Number: | 106981-52-6 |
Molecular Formula: | C16H14N2O3 |
Molecular Weight: | 282.294 |
MDL Number: | MFCD18379165 |
SMILES: | CCOc1cc(N)ccc1N1C(=O)c2c(C1=O)cccc2 |
2-(4-Amino-2-ethoxyphenyl)isoindoline-1,3-dione is a versatile compound that finds wide application in chemical synthesis. With its unique structure and reactivity, this compound is commonly used as a building block in organic chemistry reactions. Its amino and ethoxy functional groups allow for selective modifications and derivatizations, making it a valuable intermediate in the preparation of various organic molecules.In chemical synthesis, 2-(4-Amino-2-ethoxyphenyl)isoindoline-1,3-dione can be employed as a key starting material for the synthesis of complex heterocyclic compounds, pharmaceutical intermediates, and specialty chemicals. Its presence facilitates the introduction of functional groups, stereochemical control, and the formation of diverse structural motifs in target molecules. Additionally, the isoindoline-1,3-dione moiety in this compound serves as a privileged scaffold in drug discovery and agrochemical research.Overall, the versatile nature of 2-(4-Amino-2-ethoxyphenyl)isoindoline-1,3-dione makes it a valuable tool for organic chemists seeking to design and synthesize novel compounds with specific properties and biological activities.