AB73678
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | 2 weeks | $214.00 | $150.00 | - + | |
1g | 97% | 2 weeks | $506.00 | $355.00 | - + | |
5g | 97% | 2 weeks | $1,520.00 | $1,064.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB73678 |
Chemical Name: | Ethyl 3-(4-hydroxyphenyl)-5-methylisoxazole-4-carboxylate |
CAS Number: | 1071788-87-8 |
Molecular Formula: | C13H13NO4 |
Molecular Weight: | 247.2466 |
MDL Number: | MFCD22372653 |
SMILES: | CCOC(=O)c1c(C)onc1c1ccc(cc1)O |
Ethyl 3-(4-hydroxyphenyl)-5-methylisoxazole-4-carboxylate is a versatile compound widely utilized in chemical synthesis for its unique structural features and reactivity. This compound serves as a key building block in the synthesis of various pharmaceuticals, agrochemicals, and materials. Its specific application in chemical synthesis includes:1. Medicinal Chemistry: Ethyl 3-(4-hydroxyphenyl)-5-methylisoxazole-4-carboxylate plays a crucial role in the synthesis of bioactive molecules with potential pharmacological activities. Its presence in the molecular structure imparts specific properties that are essential for drug design and development.2. Agrochemical Synthesis: This compound is utilized in the creation of pesticides, herbicides, and fungicides due to its ability to enhance the biological activity and efficacy of these agricultural chemicals. Its incorporation in the synthesis leads to the production of compounds with improved pest control properties.3. Material Science: Ethyl 3-(4-hydroxyphenyl)-5-methylisoxazole-4-carboxylate is employed in the fabrication of advanced materials with tailored properties. By integrating this compound into the synthesis process, researchers can modulate the physical and chemical characteristics of the resulting materials, making them suitable for various industrial applications.Overall, the diverse applications of Ethyl 3-(4-hydroxyphenyl)-5-methylisoxazole-4-carboxylate in chemical synthesis highlight its significance in the field of organic chemistry and its pivotal role in the creation of novel compounds with desirable functionalities.