logo
Home  > (9H-Fluoren-9-yl)methyl 3-hydroxypiperidine-1-carboxylate

AE13694

1072502-05-6 | (9H-Fluoren-9-yl)methyl 3-hydroxypiperidine-1-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $319.00 $223.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE13694
Chemical Name: (9H-Fluoren-9-yl)methyl 3-hydroxypiperidine-1-carboxylate
CAS Number: 1072502-05-6
Molecular Formula: C20H21NO3
Molecular Weight: 323.38564
MDL Number: MFCD04974368
SMILES: OC1CCCN(C1)C(=O)OCC1c2ccccc2-c2c1cccc2

 

Upstream Synthesis Route 
  • (9H-Fluoren-9-yl)methyl 3-hydroxypiperidine-1-carboxylate is a versatile compound widely used in chemical synthesis due to its unique structure and reactivity. This compound serves as a valuable building block in organic synthesis, particularly in the formation of complex molecules and pharmaceutical intermediates. Its fluorenyl group offers stability and rigidity to the molecule, making it a valuable component in designing and synthesizing biologically active compounds. Additionally, the presence of the piperidine ring provides opportunities for the modification of pharmacological properties through structure-activity relationships. Overall, (9H-Fluoren-9-yl)methyl 3-hydroxypiperidine-1-carboxylate plays a crucial role in modern organic chemistry by enabling the efficient and targeted synthesis of a wide range of functional molecules.
FEATURED PRODUCTS