AD64249
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $86.00 | $60.00 | - + | |
250mg | 98% | in stock | $97.00 | $68.00 | - + | |
1g | 98% | in stock | $217.00 | $152.00 | - + | |
5g | 98% | in stock | $642.00 | $449.00 | - + | |
10g | 98% | in stock | $1,247.00 | $873.00 | - + | |
25g | 98% | in stock | $2,437.00 | $1,706.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD64249 |
Chemical Name: | 4-Formyl-3-(trifluoromethyl)phenylboronic acid |
CAS Number: | 1072944-24-1 |
Molecular Formula: | C8H6BF3O3 |
Molecular Weight: | 217.9376 |
MDL Number: | MFCD09037498 |
SMILES: | O=Cc1ccc(cc1C(F)(F)F)B(O)O |
Complexity: | 232 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
The compound (4-Formyl-3-(trifluoromethyl)phenyl)boronic acid, also known as $name$, serves as a versatile building block in chemical synthesis. Its unique structure consisting of a boronic acid and a trifluoromethyl group allows for a variety of applications in organic chemistry. One common use of (4-Formyl-3-(trifluoromethyl)phenyl)boronic acid is as a key reagent in Suzuki-Miyaura cross-coupling reactions. In this process, the boronic acid moiety undergoes a palladium-catalyzed coupling with an organic halide or pseudohalide, resulting in the formation of a new carbon-carbon bond. This reaction is widely employed in the synthesis of biologically active compounds, pharmaceuticals, and materials.Additionally, the trifluoromethyl group on (4-Formyl-3-(trifluoromethyl)phenyl)boronic acid imparts unique properties to the resulting products, making them useful in medicinal chemistry and agrochemical research. The presence of the trifluoromethyl group can enhance the chemical and biological properties of the synthesized molecules, increasing their potency or selectivity.Overall, (4-Formyl-3-(trifluoromethyl)phenyl)boronic acid is a valuable tool for chemists engaged in the design and synthesis of complex molecules with diverse applications in various fields of research.