AD45549
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $69.00 | $49.00 | - + | |
1g | 98% | in stock | $166.00 | $116.00 | - + | |
5g | 98% | in stock | $631.00 | $442.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD45549 |
Chemical Name: | 2,6-Dichloro-3-nitrophenylboronic acid |
CAS Number: | 1072946-37-2 |
Molecular Formula: | C6H4BCl2NO4 |
Molecular Weight: | 235.8173 |
MDL Number: | MFCD10699640 |
SMILES: | OB(c1c(Cl)ccc(c1Cl)[N+](=O)[O-])O |
Complexity: | 224 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
The application of (2,6-Dichloro-3-nitrophenyl)boronic acid in chemical synthesis involves its use as a valuable building block in the preparation of various organic compounds. This compound serves as a versatile reagent in Suzuki-Miyaura cross-coupling reactions, allowing for the efficient formation of carbon-carbon bonds. Additionally, it is utilized in the synthesis of pharmaceuticals, agrochemicals, and materials science due to its reactivity and ability to introduce functional groups. Moreover, (2,6-Dichloro-3-nitrophenyl)boronic acid is a key intermediate in the development of novel molecules with diverse applications in the field of chemistry.