AB50465
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 96% | in stock | $265.00 | $186.00 | - + | |
5g | 96% | in stock | $976.00 | $683.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50465 |
Chemical Name: | 4-(1,3-Dioxolan-2-yl)-2,6-difluorophenylboronic acid |
CAS Number: | 1072946-41-8 |
Molecular Formula: | C9H9BF2O4 |
Molecular Weight: | 229.9732 |
MDL Number: | MFCD11053806 |
SMILES: | OB(c1c(F)cc(cc1F)C1OCCO1)O |
Complexity: | 226 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
The 4-(1,3-Dioxolan-2-yl)-2,6-difluorophenylboronic acid is a versatile compound commonly utilized in chemical synthesis as a key building block in organic reactions. Due to its boronic acid functionality, this compound is particularly valued in Suzuki-Miyaura cross-coupling reactions, allowing for the efficient formation of carbon-carbon bonds. Additionally, the presence of the difluorophenyl group enhances the reactivity and selectivity of the compound in various transformations. This compound is employed in the synthesis of pharmaceutical intermediates, agrochemicals, and materials science applications, showcasing its significance in modern organic chemistry.