logo
Home  > Demethylzeylasteral

AE17177

107316-88-1 | Demethylzeylasteral

Packsize Purity Availability Price Discounted Price    Quantity
1mg 99% in stock $19.00 $13.00 -   +
25mg 99% in stock $89.00 $62.00 -   +
50mg 99% in stock $149.00 $104.00 -   +
100mg 99% in stock $250.00 $175.00 -   +
250mg 99% in stock $349.00 $245.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE17177
Chemical Name: Demethylzeylasteral
CAS Number: 107316-88-1
Molecular Formula: C29H36O6
Molecular Weight: 480.5925
MDL Number: MFCD16660658
SMILES: O=Cc1c(O)c(O)cc2c1C(=O)C=C1[C@@]2(C)CC[C@@]2([C@]1(C)CC[C@@]1([C@H]2C[C@](CC1)(C)C(=O)O)C)C

 

Upstream Synthesis Route 
  • Demethylzeylasteral, a naturally occurring triterpenoid compound derived from plants, plays a crucial role in chemical synthesis as a versatile building block. Its unique structure and reactivity make it a valuable tool in the development of innovative organic reactions and the creation of complex molecules. With its potential to undergo various transformations, Demethylzeylasteral serves as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and other important organic compounds. Its ability to participate in diverse chemical reactions makes it a valuable asset in the synthesis of novel compounds with potential applications across different industries.
FEATURED PRODUCTS