logo
Home  > cis-4-(Trifluoromethyl)cyclohexanamine

AI68888

1073266-01-9 | cis-4-(Trifluoromethyl)cyclohexanamine

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% in stock $319.00 $223.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AI68888
Chemical Name: cis-4-(Trifluoromethyl)cyclohexanamine
CAS Number: 1073266-01-9
Molecular Formula: C7H12F3N
Molecular Weight: 167.17208960000002
MDL Number: MFCD19686543
SMILES: N[C@@H]1CC[C@@H](CC1)C(F)(F)F

 

Upstream Synthesis Route 
  • The cis-4-(Trifluoromethyl)cyclohexanamine is a versatile compound that finds wide application in chemical synthesis. Its unique chemical structure allows it to participate in various reactions and transformations, making it a valuable building block for the synthesis of advanced molecules. In particular, this compound is often employed as a chiral auxiliary in asymmetric synthesis, where its stereochemistry plays a crucial role in determining the stereochemical outcome of the reaction. Additionally, cis-4-(Trifluoromethyl)cyclohexanamine can serve as a precursor for the preparation of other fluorinated compounds, which are of interest in medicinal chemistry and materials science. Overall, the use of cis-4-(Trifluoromethyl)cyclohexanamine in chemical synthesis showcases its important role in enabling the creation of diverse and complex molecular structures with specific stereochemical and functional group arrangements.
FEATURED PRODUCTS