AD45383
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $30.00 | $21.00 | - + | |
250mg | 98% | in stock | $50.00 | $35.00 | - + | |
1g | 98% | in stock | $149.00 | $105.00 | - + | |
5g | 98% | in stock | $592.00 | $414.00 | - + | |
10g | 98% | in stock | $1,127.00 | $789.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD45383 |
Chemical Name: | 4-(4-Isopropylpiperizinyl)phenylboronic acid, pinacol ester |
CAS Number: | 1073354-18-3 |
Molecular Formula: | C19H31BN2O2 |
Molecular Weight: | 330.2726 |
MDL Number: | MFCD06795656 |
SMILES: | CC(N1CCN(CC1)c1ccc(cc1)B1OC(C(O1)(C)C)(C)C)C |
Complexity: | 409 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 3 |
4-(4-Isopropylpiperazinyl)phenylboronic acid, pinacol ester is a versatile reagent commonly used in chemical synthesis. It serves as a key building block in the field of organic chemistry, particularly in the development of pharmaceuticals, agrochemicals, and materials science. This compound is highly valued for its ability to facilitate carbon-carbon bond formation through Suzuki-Miyaura cross-coupling reactions. Through its boronic acid functionality, it can effectively react with a variety of electrophiles, such as aryl halides or triflates, leading to the formation of complex molecular structures with high efficiency and selectivity.Additionally, the pinacol ester moiety in the molecule provides stability and enables easy handling and storage of the reagent, making it a convenient choice for laboratories and industrial settings. Its compatibility with a wide range of reaction conditions and functional groups further enhances its utility in diverse synthetic applications.Overall, 4-(4-Isopropylpiperazinyl)phenylboronic acid, pinacol ester plays a crucial role in advancing chemical synthesis strategies, allowing researchers to construct complex molecules with precision and effectiveness.