AB61728
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $35.00 | $25.00 | - + | |
1g | 98% | in stock | $102.00 | $71.00 | - + | |
5g | 98% | in stock | $404.00 | $283.00 | - + | |
10g | 98% | in stock | $788.00 | $552.00 | - + | |
25g | 98% | in stock | $1,940.00 | $1,358.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB61728 |
Chemical Name: | 3-Amino-2-chloropyridine-5-boronic acid, pinacol ester |
CAS Number: | 1073354-96-7 |
Molecular Formula: | C11H16BClN2O2 |
Molecular Weight: | 254.5209 |
MDL Number: | MFCD09260487 |
SMILES: | Clc1ncc(cc1N)B1OC(C(O1)(C)C)(C)C |
Complexity: | 285 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
2-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine is a versatile compound widely utilized in chemical synthesis for its unique properties. This compound serves as a valuable building block in the preparation of organic molecules through Suzuki-Miyaura cross-coupling reactions. By introducing this specific functional group into target molecules, researchers can effectively modify their chemical structures, enabling the synthesis of diverse compounds with tailored properties. The presence of the boron-containing moiety in 2-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine facilitates selective transformations and enables the formation of complex molecular architectures. This compound finds applications across various fields of organic chemistry, including medicinal chemistry, materials science, and agrochemical research.