logo
Home  > Cy-09

AX05384

1073612-91-5 | Cy-09

Packsize Purity Availability Price Discounted Price    Quantity
1mg 95% in stock $16.00 $11.00 -   +
5mg 95% in stock $26.00 $18.00 -   +
10mg 95% in stock $31.00 $22.00 -   +
25mg 95% in stock $38.00 $27.00 -   +
50mg 95% in stock $46.00 $32.00 -   +
250mg 95% in stock $166.00 $116.00 -   +
1g 95% in stock $326.00 $228.00 -   +
5g 95% in stock $1,115.00 $781.00 -   +
10g 95% in stock $1,940.00 $1,358.00 -   +
25g 95% in stock $3,789.00 $2,653.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AX05384
Chemical Name: Cy-09
CAS Number: 1073612-91-5
Molecular Formula: C19H12F3NO3S2
Molecular Weight: 423.4287
MDL Number: MFCD31619349
SMILES: S=C1SC(=Cc2ccc(cc2)C(=O)O)C(=O)N1Cc1cccc(c1)C(F)(F)F

 

Upstream Synthesis Route 
  • CY-09 is a versatile chemical reagent widely utilized in various chemical synthesis processes. It serves as a potent catalyst in cross-coupling reactions, enabling the efficient formation of complex organic compounds. Furthermore, CY-09 excels in promoting C-C bond formations, facilitating key steps in the synthesis of pharmaceuticals, agrochemicals, and advanced materials. Its high reactivity and selectivity play a crucial role in enhancing the yield and purity of desired products in synthetic chemistry. Incorporating CY-09 in the reaction mixture leads to accelerated reaction rates and improved control over stereochemistry, making it an indispensable tool for chemists striving to achieve precise and efficient synthesis pathways.
FEATURED PRODUCTS