AE25110
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $20.00 | $14.00 | - + | |
1g | 97% | in stock | $20.00 | $14.00 | - + | |
5g | 97% | in stock | $99.00 | $70.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE25110 |
Chemical Name: | Triisopropyl[(trimethylsilyl)ethynyl]silane |
CAS Number: | 107474-02-2 |
Molecular Formula: | C14H30Si2 |
Molecular Weight: | 254.559 |
MDL Number: | MFCD28975120 |
SMILES: | CC([Si](C(C)C)(C(C)C)C#C[Si](C)(C)C)C |
Complexity: | 259 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Rotatable Bond Count: | 5 |
Triisopropyl[(trimethylsilyl)ethynyl]silane, commonly known as TIPETS, is a versatile organosilicon compound widely used in chemical synthesis. Its unique structure, featuring a terminal ethynyl group with trimethylsilyl and isopropyl substituents, makes it a valuable reagent in various synthetic applications.One of the key uses of TIPETS is as a silylating agent in organic chemistry. It can selectively introduce a trimethylsilyl group onto alcohols, amines, and other functional groups, facilitating further reactions or protecting sensitive functionalities during synthesis. This silyl group can be easily removed under mild conditions, making TIPETS a valuable tool for organic chemists working on complex molecule synthesis.Additionally, TIPETS is employed in the preparation of organosilicon compounds, particularly in the construction of silicon-containing polymers and materials. Its ethynyl functionality allows for further elaboration through cross-coupling reactions, enabling the creation of new silicon-based compounds with tailored properties.Furthermore, TIPETS can be utilized in the synthesis of biologically active compounds, pharmaceutical intermediates, and advanced materials due to its ability to introduce functional groups selectively and efficiently. Its compatibility with various reaction conditions and its stable nature make it a valuable reagent in modern chemical synthesis strategies.