AB68914
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 97% | in stock | $9.00 | $7.00 | - + | |
100g | 97% | in stock | $159.00 | $111.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB68914 |
Chemical Name: | 5-Bromo-2-methyl-3-nitrobenzoic acid |
CAS Number: | 107650-20-4 |
Molecular Formula: | C8H6BrNO4 |
Molecular Weight: | 260.0415 |
MDL Number: | MFCD07357316 |
SMILES: | Brc1cc([N+](=O)[O-])c(c(c1)C(=O)O)C |
Complexity: | 252 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.3 |
The upstream synthesis of 5-Bromo-2-methyl-3-nitrobenzoic acid can be approached as follows: 1. Begin with Toluene as the starting material. 2. Carry out a Friedel-Crafts acylation of Toluene with bromoacetyl bromide in the presence of an aluminum chloride (AlCl3) catalyst to obtain 2-bromo-1-methylacetophenone. 3. Subject 2-bromo-1-methylacetophenone to nitration using a mixture of nitric acid and sulfuric acid to introduce the nitro group, producing 3-nitro-2-bromo-1-methylacetophenone. 4. Hydrolyze the keto group in 3-nitro-2-bromo-1-methylacetophenone with a strong base, such as sodium hydroxide, followed by acidification to yield 5-Bromo-2-methyl-3-nitrobenzoic acid. Each step should be optimized for yield, purity, and regioselectivity, and may require further refinement depending on scale and application of the final product.