logo
Home  > Alpha,alpha',2,3,5,6-hexachloro-p-xylene

AB70557

1079-17-0 | Alpha,alpha',2,3,5,6-hexachloro-p-xylene

Packsize Purity Availability Price Discounted Price    Quantity
250mg 98% in stock $38.00 $27.00 -   +
1g 98% in stock $48.00 $33.00 -   +
5g 98% in stock $124.00 $87.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB70557
Chemical Name: Alpha,alpha',2,3,5,6-hexachloro-p-xylene
CAS Number: 1079-17-0
Molecular Formula: C8H4Cl6
Molecular Weight: 312.8354
MDL Number: MFCD00000894
SMILES: ClCc1c(Cl)c(Cl)c(c(c1Cl)Cl)CCl

 

Upstream Synthesis Route 
  • Alpha,alpha,2,3,5,6-hexachloro-p-xylene is a versatile compound used in various chemical synthesis processes. Due to its unique structure and properties, it serves as a crucial building block in organic synthesis, particularly in the development of agrochemicals and pharmaceuticals. Its high chemical reactivity allows for the efficient formation of complex molecular structures, making it a valuable tool for chemists working in diverse industries. Additionally, Alpha,alpha,2,3,5,6-hexachloro-p-xylene has found applications in environmental remediation due to its potential as a potent chlorinated solvent and pesticide. Its wide range of applications underscores its significance in modern chemical research and development.
FEATURED PRODUCTS