AE22487
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10mg | 95% | in stock | $150.00 | $105.00 | - + | |
50mg | 95% | in stock | $268.00 | $188.00 | - + | |
1g | 95% | in stock | $2,622.00 | $1,835.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE22487 |
Chemical Name: | 7-Bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
CAS Number: | 108061-47-8 |
Molecular Formula: | C11H11BrN2 |
Molecular Weight: | 251.1224 |
MDL Number: | MFCD21337853 |
SMILES: | Brc1ccc2c(c1)[nH]c1c2CCNC1 |
7-Bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole is a versatile compound that finds significant application in chemical synthesis processes. This compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and materials.In chemical synthesis, 7-Bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole is frequently employed as a precursor for the synthesis of complex heterocyclic compounds. Its unique structural features make it a valuable intermediate for the formation of diverse molecular structures with specific properties. Additionally, this compound can be utilized in the development of novel organic molecules with potential applications in medicinal chemistry and materials science.Due to its reactive nature and strategic placement of the bromine moiety, 7-Bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole exhibits excellent reactivity in various synthetic transformations such as cross-coupling reactions, nucleophilic substitutions, and cascade reactions. Its involvement in multi-step synthesis routes allows for the efficient construction of complex molecules with desired stereochemical arrangements.Overall, the use of 7-Bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole in chemical synthesis enables researchers to access diverse chemical space, drive innovation in drug discovery, and facilitate the development of advanced materials with tailored properties and functions.