AB55740
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 96% | in stock | $24.00 | $17.00 | - + | |
250mg | 96% | in stock | $37.00 | $26.00 | - + | |
1g | 96% | in stock | $58.00 | $41.00 | - + | |
5g | 96% | in stock | $209.00 | $147.00 | - + | |
10g | 96% | in stock | $370.00 | $259.00 | - + | |
25g | 96% | in stock | $735.00 | $515.00 | - + | |
100g | 96% | in stock | $2,623.00 | $1,836.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB55740 |
Chemical Name: | (R)-4-Hydroxymethyl-2,2-dimethyl-oxazolidine-3-carboxylic acid tert-butyl ester |
CAS Number: | 108149-63-9 |
Molecular Formula: | C11H21NO4 |
Molecular Weight: | 231.2887 |
MDL Number: | MFCD06202686 |
SMILES: | OC[C@@H]1COC(N1C(=O)OC(C)(C)C)(C)C |
Complexity: | 270 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.8 |
The compound (R)-tert-Butyl 4-(hydroxymethyl)-2,2-dimethyloxazolidine-3-carboxylate is a versatile building block in chemical synthesis. Its unique structure containing both an oxazolidine ring and a tert-butyl ester group allows it to participate in a variety of synthetic reactions, making it a valuable reagent in organic chemistry.One common application of (R)-tert-Butyl 4-(hydroxymethyl)-2,2-dimethyloxazolidine-3-carboxylate is in asymmetric synthesis. As a chiral compound, it can serve as a chiral auxiliary or ligand in asymmetric transformations, enabling the selective formation of enantiomerically pure products. This is particularly useful in the pharmaceutical industry where enantiomeric purity is often crucial for drug efficacy and safety.Furthermore, the hydroxymethyl group in the molecule can undergo various functional group transformations, allowing for the introduction of additional chemical functionalities through selective reactions. This flexibility makes (R)-tert-Butyl 4-(hydroxymethyl)-2,2-dimethyloxazolidine-3-carboxylate a valuable tool in the design and synthesis of complex organic molecules for a range of applications in medicine, materials science, and other fields of chemistry.