AE24903
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $59.00 | $41.00 | - + | |
1g | 98% | in stock | $89.00 | $63.00 | - + | |
5g | 98% | in stock | $361.00 | $253.00 | - + | |
10g | 98% | in stock | $715.00 | $501.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE24903 |
Chemical Name: | Methyl 2,3-dichloroquinoxaline-6-carboxylate |
CAS Number: | 108258-54-4 |
Molecular Formula: | C10H6Cl2N2O2 |
Molecular Weight: | 257.0728 |
MDL Number: | MFCD12827814 |
SMILES: | COC(=O)c1ccc2c(c1)nc(c(n2)Cl)Cl |
Complexity: | 278 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 2 |
XLogP3: | 3 |
Methyl 2,3-dichloroquinoxaline-6-carboxylate is a versatile compound commonly used in chemical synthesis for the preparation of various organic molecules. It serves as a valuable building block in the production of pharmaceuticals, agrochemicals, and materials with diverse applications. This compound is particularly useful in the development of new drugs and biologically active compounds due to its unique chemical structure and reactivity. Additionally, Methyl 2,3-dichloroquinoxaline-6-carboxylate is employed in the synthesis of complex organic frameworks and heterocyclic compounds, making it an essential tool for chemists and researchers in the field of organic chemistry.