AE11440
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | in stock | $19.00 | $13.00 | - + | |
5mg | 99% | in stock | $23.00 | $16.00 | - + | |
10mg | 99% | in stock | $30.00 | $21.00 | - + | |
50mg | 99% | in stock | $83.00 | $58.00 | - + | |
100mg | 99% | in stock | $142.00 | $99.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11440 |
Chemical Name: | Ly2584702 tosylate |
CAS Number: | 1082949-68-5 |
Molecular Formula: | C28H27F4N7O3S |
Molecular Weight: | 617.6176927999999 |
MDL Number: | MFCD29054739 |
SMILES: | Cn1cc(nc1C1CCN(CC1)c1ncnc2c1cn[nH]2)c1ccc(c(c1)C(F)(F)F)F.Cc1ccc(cc1)S(=O)(=O)O |
Complexity: | 851 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 43 |
Hydrogen Bond Acceptor Count: | 12 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
LY2584702 Tosylate is a valuable compound utilized in chemical synthesis for its unique properties and applications. As a potent kinase inhibitor, it plays a crucial role in inhibiting the activity of various kinases within biological systems. This interference with kinase activity is particularly beneficial in studies focusing on signal transduction pathways and cellular processes. In chemical synthesis, LY2584702 Tosylate serves as a versatile building block for creating intricate molecular structures and designing novel bioactive compounds. Its compatibility with a wide range of reaction conditions and its ability to modulate kinase functions make it an indispensable tool for researchers and chemists alike. By incorporating LY2584702 Tosylate into synthesis pathways, scientists can explore new ways to manipulate cellular signaling cascades and develop innovative therapeutic agents with potential applications in drug discovery and biotechnology.
European journal of cancer (Oxford, England : 1990) 20140301
European journal of cancer (Oxford, England : 1990) 20140301