AB69246
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $43.00 | $30.00 | - + | |
250mg | 95% | in stock | $63.00 | $45.00 | - + | |
1g | 95% | in stock | $171.00 | $120.00 | - + | |
5g | 95% | in stock | $668.00 | $468.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB69246 |
Chemical Name: | 5-Fluoro-2-methoxypyridine-3-boronic acid pinacol ester |
CAS Number: | 1083168-95-9 |
Molecular Formula: | C12H17BFNO3 |
Molecular Weight: | 253.0777 |
MDL Number: | MFCD08063053 |
SMILES: | COc1ncc(cc1B1OC(C(O1)(C)C)(C)C)F |
Complexity: | 298 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 2 |
5-Fluoro-2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a versatile chemical compound commonly used in organic synthesis. Its key application lies in its role as a powerful building block for the synthesis of complex molecules and pharmaceutical compounds.This compound is frequently employed in transition metal-catalyzed coupling reactions, such as Suzuki-Miyaura cross-coupling, where it serves as an organoboron reagent. The unique structure of 5-Fluoro-2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine enables efficient and selective coupling with various aryl halides or pseudohalides, leading to the formation of new carbon-carbon bonds.Moreover, the presence of a fluorine atom in the molecule enhances its reactivity and can impart important properties to the final synthesized products. This compound has found widespread use in the construction of biologically active molecules, agrochemicals, and materials with tailored properties, showcasing its significance in modern chemical synthesis strategies.