AE08285
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $26.00 | $18.00 | - + | |
25g | 95% | in stock | $58.00 | $41.00 | - + | |
100g | 95% | in stock | $163.00 | $114.00 | - + | |
500g | 95% | in stock | $575.00 | $402.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE08285 |
Chemical Name: | PIPERAZINE-N,N'-BIS-(2-ETHANESULPHONIC ACID) DIPOTASSIUM SALT |
CAS Number: | 108321-27-3 |
Molecular Formula: | C8H16K2N2O6S2 |
Molecular Weight: | 378.549 |
MDL Number: | MFCD00069751 |
SMILES: | [O-]S(=O)(=O)CCN1CCN(CC1)CCS(=O)(=O)[O-].[K+].[K+] |
Complexity: | 370 |
Covalently-Bonded Unit Count: | 3 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 8 |
Rotatable Bond Count: | 4 |
Potassium 2,2'-(piperazine-1,4-diyl)diethanesulfonate is a versatile compound that finds significant utility in chemical synthesis processes. This compound serves as an effective reagent in the synthesis of various organic molecules and pharmaceutical agents due to its unique properties. In particular, it is commonly employed as a potent base in organic reactions, facilitating the deprotonation of acidic compounds and enabling the formation of new carbon-carbon or carbon-nitrogen bonds. Additionally, Potassium 2,2'-(piperazine-1,4-diyl)diethanesulfonate is utilized as a stabilizing agent in certain reactions, ensuring the desired product is obtained in high yields with excellent purity. Its ability to act as a catalyst in specific transformations further enhances its importance in chemical synthesis, allowing for the efficient production of complex molecules. The compound's compatibility with a wide range of reaction conditions and substrates makes it a valuable tool for chemists seeking to streamline their synthetic procedures and achieve precise control over their molecular designs.