AE18545
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $110.00 | $77.00 | - + | |
250mg | 97% | in stock | $180.00 | $126.00 | - + | |
1g | 97% | in stock | $589.00 | $412.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE18545 |
Chemical Name: | 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinesulfonamide |
CAS Number: | 1083326-26-4 |
Molecular Formula: | C11H17BN2O4S |
Molecular Weight: | 284.1397 |
MDL Number: | MFCD13190590 |
SMILES: | CC1(C)OB(OC1(C)C)c1cncc(c1)S(=O)(=O)N |
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-sulfonamide is a versatile reagent widely used in chemical synthesis as a key building block. Its unique structure allows for efficient functionalization of various organic molecules through Suzuki-Miyaura cross-coupling reactions. This compound serves as a critical component in the synthesis of pharmaceuticals, agrochemicals, and materials science compounds, enabling chemists to access a diverse array of molecular structures with high efficiency and precision.