AI07427
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $95.00 | $67.00 | - + | |
250mg | 95% | in stock | $143.00 | $100.00 | - + | |
1g | 95% | in stock | $401.00 | $281.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI07427 |
Chemical Name: | 2,3,4,6-Tetra-o-pivaloyl-d-galactopyranosylamine |
CAS Number: | 108342-87-6 |
Molecular Formula: | C26H45NO9 |
Molecular Weight: | 515.6368 |
MDL Number: | MFCD00153054 |
SMILES: | N[C@@H]1O[C@H](COC(=O)C(C)(C)C)[C@@H]([C@@H]([C@H]1OC(=O)C(C)(C)C)OC(=O)C(C)(C)C)OC(=O)C(C)(C)C |
Complexity: | 824 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 5 |
Heavy Atom Count: | 36 |
Hydrogen Bond Acceptor Count: | 10 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 13 |
XLogP3: | 5.4 |
The Journal of organic chemistry 20080118
Chirality 20020101