logo
Home  > Benzyl N,N,N',N'-Tetraisopropylphosphorodiamidite

BA00790

108549-21-9 | Benzyl N,N,N',N'-Tetraisopropylphosphorodiamidite

Packsize Purity Availability Price Discounted Price    Quantity
250mg 98% in stock $90.00 $63.00 -   +
1g 98% in stock $161.00 $113.00 -   +
5g 98% in stock $482.00 $337.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: BA00790
Chemical Name: Benzyl N,N,N',N'-Tetraisopropylphosphorodiamidite
CAS Number: 108549-21-9
Molecular Formula: C19H35N2OP
Molecular Weight: 338.4678
MDL Number: MFCD32062870
SMILES: CC(N(P(N(C(C)C)C(C)C)OCc1ccccc1)C(C)C)C

 

Upstream Synthesis Route
  • 1-(Benzyloxy)-N,N,N',N'-tetraisopropylphosphinediamine, commonly referred to as $name$, is a versatile reagent utilized in various chemical synthesis processes. This compound serves as an effective ligand, particularly in transition metal-catalyzed reactions, due to its unique structural features. As a phosphine-based ligand, $name$ plays a crucial role in coordinating metal ions, facilitating complex formation and influencing the course of chemical reactions. Its steric and electronic properties make it suitable for a wide range of catalytic transformations, such as cross-coupling reactions, hydrogenation, and C-H activation. Moreover, the presence of the benzyloxy moiety enhances the solubility and stability of the complex, further improving its efficacy in synthetic applications. Overall, 1-(Benzyloxy)-N,N,N',N'-tetraisopropylphosphinediamine is a valuable tool in modern organic synthesis, enabling the efficient preparation of diverse chemical compounds with high selectivity and yield.
FEATURED PRODUCTS