AE11234
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $48.00 | $34.00 | - + | |
2mg | 95% | in stock | $67.00 | $47.00 | - + | |
5mg | 95% | in stock | $108.00 | $76.00 | - + | |
10mg | 95% | in stock | $159.00 | $111.00 | - + | |
25mg | 95% | in stock | $322.00 | $225.00 | - + | |
100mg | 95% | in stock | $347.00 | $243.00 | - + | |
250mg | 95% | in stock | $580.00 | $406.00 | - + | |
1g | 95% | in stock | $1,535.00 | $1,074.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11234 |
Chemical Name: | Gsk2126458 |
CAS Number: | 1086062-66-9 |
Molecular Formula: | C25H17F2N5O3S |
Molecular Weight: | 505.496 |
MDL Number: | MFCD16038929 |
SMILES: | COc1ncc(cc1NS(=O)(=O)c1ccc(cc1F)F)c1ccc2c(c1)c(ccn2)c1ccnnc1 |
Complexity: | 833 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 36 |
Hydrogen Bond Acceptor Count: | 10 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 6 |
XLogP3: | 3.3 |
Omipalisib is a potent and selective inhibitor of phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit alpha (PIK3CA), a key enzyme involved in the PI3K/AKT/mTOR signaling pathway. This pathway plays a crucial role in regulating cell growth, proliferation, and survival, making it a promising target for cancer therapy. In the realm of chemical synthesis, Omipalisib's unique mechanism of action can be leveraged to selectively inhibit the PI3K pathway in cancer cells, potentially leading to the development of novel anticancer agents. By modulating this signaling pathway, Omipalisib has the potential to impact various cellular processes that are critically involved in tumorigenesis, offering new avenues for the design and synthesis of targeted chemotherapeutic agents.
Thorax 20160801
Bioorganic & medicinal chemistry letters 20130801
Clinical cancer research : an official journal of the American Association for Cancer Research 20120815
Bioorganic & medicinal chemistry letters 20120215
Cancer biology & therapy 20110601
ACS medicinal chemistry letters 20100408