logo
Home  > 3-Bromo-5-(trifluoromethyl)-1h-indazole

AE28153

1086378-32-6 | 3-Bromo-5-(trifluoromethyl)-1h-indazole

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% in stock $80.00 $56.00 -   +
5g 98% in stock $400.00 $280.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE28153
Chemical Name: 3-Bromo-5-(trifluoromethyl)-1h-indazole
CAS Number: 1086378-32-6
Molecular Formula: C8H4BrF3N2
Molecular Weight: 265.03
MDL Number: MFCD09998163
SMILES: FC(c1ccc2c(c1)c(Br)n[nH]2)(F)F

 

Upstream Synthesis Route 
  • 3-Bromo-5-(trifluoromethyl)-1H-indazole is a versatile compound widely used in chemical synthesis for various applications. One common use of this compound is as a building block in the synthesis of pharmaceuticals and agrochemicals. Its unique structure and reactivity make it a valuable component in the production of complex organic molecules. Additionally, 3-Bromo-5-(trifluoromethyl)-1H-indazole is used in the development of new materials and as a reagent in organic reactions due to its ability to introduce specific functional groups into target molecules. This compound plays a crucial role in advancing research and innovation in the field of organic chemistry.
FEATURED PRODUCTS