logo
Home  > 7-(Trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylic acid

AX85951

1086380-46-2 | 7-(Trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylic acid

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AX85951
Chemical Name: 7-(Trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylic acid
CAS Number: 1086380-46-2
Molecular Formula: C10H8F3NO3
Molecular Weight: 247.1706
MDL Number: MFCD09258855
SMILES: OC(=O)C1CNc2c(O1)cc(cc2)C(F)(F)F

 

Upstream Synthesis Route 
  • 2H-1,4-Benzoxazine-2-carboxylic acid, 3,4-dihydro-7-(trifluoromethyl)- is a versatile compound widely utilized in chemical synthesis. This compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and materials due to its unique chemical properties. Its trifluoromethyl group enhances the compound's reactivity and stability, making it valuable in the synthesis of complex molecules. Additionally, the benzoxazine ring structure provides a scaffold for introducing functional groups and further modifications, allowing for a diverse range of applications in organic chemistry research and industrial production.
FEATURED PRODUCTS