1088-56-8 | Lumiflavine

Packsize	Purity	Availability	Price	Discounted Price
5mg	95%	in stock	$52.00	$36.00
10mg	95%	in stock	$98.00	$69.00
25mg	95%	in stock	$188.00	$132.00
50mg	95%	in stock	$320.00	$224.00
100mg	95%	in stock	$513.00	$359.00
250mg	95%	in stock	$849.00	$594.00

Description

• Catalog Number: AD76992
• Chemical Name: Lumiflavine
• CAS Number: 1088-56-8
• Molecular Formula: C13H12N4O2
• Molecular Weight: 256.26
• MDL Number: MFCD00042742
• SMILES: Cc1cc2nc3-c(n(c2cc1C)C)nc(=O)[nH]c3=O

Upstream Synthesis Route

Lumiflavine, also known as 7,8-dimethyl-10-(1-D-ribityl)isoalloxazine, is a potent chemical compound with significant applications in chemical synthesis. This versatile molecule plays a crucial role as a key ingredient in various chemical reactions due to its exceptional properties.In chemical synthesis, Lumiflavine serves as a potent catalyst, facilitating the formation of desired chemical products by accelerating the rate of reactions without being consumed in the process. Its unique structure and functionality enable it to participate in a wide range of organic transformations, such as oxidation, reduction, and photoredox reactions.Furthermore, Lumiflavine's ability to act as a photosensitizer makes it valuable in light-induced reactions, where it absorbs light energy and transfers it to other molecules, triggering photochemical reactions that lead to the synthesis of complex compounds. This characteristic makes Lumiflavine a valuable tool in the development of novel synthetic methodologies and the production of specialized molecules with specific properties.In summary, Lumiflavine's versatility and catalytic properties make it an indispensable component in chemical synthesis, enabling chemists to explore new reaction pathways, enhance reaction efficiency, and achieve precise control over the synthesis of complex molecules.