AE23260
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $36.00 | $26.00 | - + | |
250mg | 97% | in stock | $60.00 | $42.00 | - + | |
1g | 97% | in stock | $122.00 | $86.00 | - + | |
5g | 97% | in stock | $568.00 | $398.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE23260 |
Chemical Name: | (S)-Octahydropyrazino[2,1-c][1,4]oxazine dihydrochloride |
CAS Number: | 1089280-14-7 |
Molecular Formula: | C7H16Cl2N2O |
Molecular Weight: | 215.12074000000004 |
MDL Number: | MFCD23105798 |
SMILES: | C1NC[C@@H]2N(C1)CCOC2.Cl.Cl |
Complexity: | 118 |
Covalently-Bonded Unit Count: | 3 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
The (S)-Octahydropyrazino[2,1-c][1,4]oxazine dihydrochloride is a valuable compound utilized in chemical synthesis for the creation of complex organic molecules. This versatile reagent serves as a chiral building block in the asymmetric synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Its specific stereochemistry enables the selective introduction of chirality into target molecules, allowing chemists to efficiently produce enantiomerically pure compounds with high levels of control and precision. Due to its role in facilitating asymmetric transformations, (S)-Octahydropyrazino[2,1-c][1,4]oxazine dihydrochloride is a crucial tool in modern synthetic chemistry, enabling the synthesis of diverse molecular structures with enhanced stereochemical properties.