AB45677
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $8.00 | $5.00 | - + | |
25g | 98% | in stock | $12.00 | $9.00 | - + | |
50g | 98% | in stock | $15.00 | $10.00 | - + | |
100g | 98% | in stock | $15.00 | $11.00 | - + | |
500g | 98% | in stock | $74.00 | $52.00 | - + | |
1000g | 98% | in stock | $147.00 | $103.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB45677 |
Chemical Name: | Boc-L-pyroglutamic acid methyl ester |
CAS Number: | 108963-96-8 |
Molecular Formula: | C11H17NO5 |
Molecular Weight: | 243.2564 |
MDL Number: | MFCD06809720 |
SMILES: | COC(=O)[C@@H]1CCC(=O)N1C(=O)OC(C)(C)C |
Complexity: | 344 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 4 |
XLogP3: | 0.9 |
The Journal of organic chemistry 20051125
The Journal of organic chemistry 20030919