AE22271
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | 1 week | $1,719.00 | $1,203.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE22271 |
Chemical Name: | 2,6-Dibromo-4,4-bis(2-ethylhexyl)-4h-silolo[3,2-b:4,5-b']dithiophene |
CAS Number: | 1089687-05-7 |
Molecular Formula: | C24H36Br2S2Si |
Molecular Weight: | 576.5661 |
MDL Number: | MFCD16621138 |
SMILES: | CCCCC(C[Si]1(CC(CCCC)CC)c2cc(sc2-c2c1cc(s2)Br)Br)CC |
2,6-Dibromo-4,4-bis(2-ethylhexyl)-4H-silolo[3,2-b:4,5-b'']dithiophene is a key compound widely utilized in chemical synthesis, particularly in the field of organic electronics. This specific molecule plays a crucial role in the production of advanced materials for use in organic photovoltaic devices and organic semiconductors.In chemical synthesis, 2,6-Dibromo-4,4-bis(2-ethylhexyl)-4H-silolo[3,2-b:4,5-b'']dithiophene is employed as a building block for constructing complex organic semiconducting materials. By incorporating this compound into the molecular structure, researchers can tailor the electronic properties of the final material, such as tuning the bandgap or enhancing charge transport characteristics.Furthermore, the unique structural features of 2,6-Dibromo-4,4-bis(2-ethylhexyl)-4H-silolo[3,2-b:4,5-b'']dithiophene make it a versatile molecule for designing novel organic electronics with improved performance and stability. Its compatibility with various processing methods also makes it suitable for large-scale production of organic electronic devices.Overall, the application of 2,6-Dibromo-4,4-bis(2-ethylhexyl)-4H-silolo[3,2-b:4,5-b'']dithiophene in chemical synthesis enables the development of cutting-edge materials for next-generation organic electronic applications.