logo
Home  > 3-(2-Methoxy-5-methylphenyl)-3-phenylpropanoic acid

AD76701

109089-77-2 | 3-(2-Methoxy-5-methylphenyl)-3-phenylpropanoic acid

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% in stock $73.00 $51.00 -   +
5g 98% in stock $201.00 $141.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AD76701
Chemical Name: 3-(2-Methoxy-5-methylphenyl)-3-phenylpropanoic acid
CAS Number: 109089-77-2
Molecular Formula: C17H18O3
Molecular Weight: 270.323
MDL Number: MFCD01098026
SMILES: COc1ccc(cc1C(c1ccccc1)CC(=O)O)C

 

Upstream Synthesis Route 
  • 3-(2-Methoxy-5-methylphenyl)-3-phenylpropanoic acid is a versatile compound used in chemical synthesis. With its unique structure, this compound plays a crucial role in the creation of various pharmaceuticals, agrochemicals, and materials. Its functionality allows for the introduction of specific chemical groups during synthesis, making it a valuable building block in organic chemistry. Additionally, this compound serves as a key intermediate in the production of specialized materials and fine chemicals. Its applications extend to the development of novel drugs, advanced materials, and innovative chemical processes.
FEATURED PRODUCTS